Difference between revisions of "14-alpha-methylsteroids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-AL ENT-KAUR-16-EN-19-AL] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3221 RXN-3221] == * direction: ** LEFT-TO-RIGHT * common name: ** atp-dependent_rna_helicase_dh...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-AL ENT-KAUR-16-EN-19-AL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3221 RXN-3221] ==
−
* smiles:
+
* direction:
−
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N
+
 
* common name:
 
* common name:
−
** ent-kaurenal
+
** atp-dependent_rna_helicase_dhx30-like
−
* molecular weight:
+
* ec number:
−
** 286.456   
+
** [http://enzyme.expasy.org/EC/5.5.1.6 EC-5.5.1.6]
 
* Synonym(s):
 
* Synonym(s):
−
** ent-kaur-16-en-19-al
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7580]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-3041]][c] '''=>''' 1 [[CPD-3061]][c]
−
* [[RXN-5242]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 isoliquiritigenin[c] '''=>''' 1 (2S)-liquiritigenin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_13414]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_9838]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-2002]], isoflavonoid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2002 PWY-2002]
 +
** '''1''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-6325]], echinatin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6325 PWY-6325]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443466 443466]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06556 R06556]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.391680.html 391680]
+
{{#set: common name=atp-dependent_rna_helicase_dhx30-like}}
−
* CHEBI:
+
{{#set: ec number=EC-5.5.1.6}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29609 29609]
+
{{#set: gene associated=Tiso_gene_13414|Tiso_gene_9838}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-2002|PWY-6325}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11873 C11873]
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB36728
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))}}
+
{{#set: reconstruction source=esiliculosus}}
−
{{#set: inchi key=InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=ent-kaurenal}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=286.456    }}
+
{{#set: reconstruction source=in-silico_annotation}}
−
{{#set: common name=ent-kaur-16-en-19-al}}
+
−
{{#set: consumed by=RXN-7580}}
+
−
{{#set: produced by=RXN-5242}}
+

Revision as of 16:22, 10 January 2018

Reaction RXN-3221

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • atp-dependent_rna_helicase_dhx30-like
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 isoliquiritigenin[c] => 1 (2S)-liquiritigenin[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2002, isoflavonoid biosynthesis I: PWY-2002
    • 1 reactions found over 5 reactions in the full pathway
  • PWY-6325, echinatin biosynthesis: PWY-6325
    • 1 reactions found over 4 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=14-alpha-methylsteroids&oldid=12633"