Difference between revisions of "Tiso gene 9262"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] == * smiles: ** CC(OCCC(C([O-])=O)[N+])=O * inchi key: ** InChIKey=FCXZBWSIAGG...") |
(Created page with "Category:Gene == Gene Tiso_gene_15207 == * Synonym(s): == Reactions associated == * 3.4.22.1-RXN ** pantograph-esiliculosus == Pathways associated == == Exter...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15207 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[3.4.22.1-RXN]] |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | == | + | == Pathways associated == |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.4.22.1-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 16:22, 10 January 2018
Gene Tiso_gene_15207
- Synonym(s):