Difference between revisions of "PWY-2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6897 PWY-6897] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6897 PWY-6897] ==
−
* smiles:
+
* taxonomic range:
−
** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
+
 
* common name:
 
* common name:
−
** 15,16-dihydrobiliverdin
+
** thiamine salvage II
−
* molecular weight:
+
−
** 582.655   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** thiamin salvage II
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[1.3.7.3-RXN]]
+
* '''3''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[THIAZOLSYN3-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** [[PWY-6910]]
 +
** [[THI-P-SYN-RXN]]
 +
== Reaction(s) not found ==
 +
* '''1''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=THI-P-KIN-RXN THI-P-KIN-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6897 PWY-6897]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899]
+
{{#set: common name=thiamine salvage II}}
−
{{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: common name=thiamin salvage II}}
−
{{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}}
+
{{#set: reaction found=3}}
−
{{#set: common name=15,16-dihydrobiliverdin}}
+
{{#set: reaction not found=1}}
−
{{#set: molecular weight=582.655    }}
+
−
{{#set: consumed by=1.3.7.3-RXN}}
+

Revision as of 16:23, 10 January 2018

Pathway PWY-6897

  • taxonomic range:
  • common name:
    • thiamine salvage II
  • Synonym(s):
    • thiamin salvage II

Reaction(s) found

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-2&oldid=12704"