Difference between revisions of "Tiso gene 12019"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == * smiles: ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) * inchi key: ** InChIKey=PX...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7767 PWY-7767] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7767 PWY-7767] ==
−
* smiles:
+
* taxonomic range:
−
** C1(=NC2(=C(NC1)N=C(N)NC(=O)2))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 7,8-dihydropterin
+
** leucine degradation IV
−
* molecular weight:
+
−
** 165.154   
+
 
* Synonym(s):
 
* Synonym(s):
−
** dihydropterin
 
−
** H2-pterin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-15261]]
+
* '''1''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
−
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''4''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-16247 RXN-16247]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-16246 RXN-16246]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-16245 RXN-16245]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-17524 RXN-17524]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65260 65260]
+
{{#set: common name=leucine degradation IV}}
−
* CHEMSPIDER:
+
{{#set: reaction found=1}}
−
** [http://www.chemspider.com/Chemical-Structure.58752.html 58752]
+
{{#set: reaction not found=4}}
−
{{#set: smiles=C1(=NC2(=C(NC1)N=C(N)NC(=O)2))}}
+
−
{{#set: inchi key=InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N}}
+
−
{{#set: common name=7,8-dihydropterin}}
+
−
{{#set: molecular weight=165.154    }}
+
−
{{#set: common name=dihydropterin|H2-pterin}}
+
−
{{#set: consumed by=RXN-15261}}
+

Revision as of 16:23, 10 January 2018

Pathway PWY-7767

  • taxonomic range:
  • common name:
    • leucine degradation IV
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12019&oldid=12707"