Difference between revisions of "Tiso gene 2246"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * smiles: ** [CH](=O)CCCC([N+])C(=O)[O-] * inchi key: ** InChIKey=GFXYTQP...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5441 PWY-5441] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5441 PWY-5441] == |
− | * | + | * taxonomic range: |
− | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** S-methyl-L-methionine cycle |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** SMM cycle |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * | + | * '''1''' reaction(s) found |
− | + | ** [[MMUM-RXN]] | |
− | * [[ | + | == Reaction(s) not found == |
− | == Reaction(s) | + | * '''1''' reaction(s) not found |
− | * [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=METHIONINE-S-METHYLTRANSFERASE-RXN METHIONINE-S-METHYLTRANSFERASE-RXN] |
− | + | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5441 PWY-5441] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-3193}} |
− | + | {{#set: common name=S-methyl-L-methionine cycle}} | |
− | + | {{#set: common name=SMM cycle}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=1}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:24, 10 January 2018
Pathway PWY-5441
- taxonomic range:
- common name:
- S-methyl-L-methionine cycle
- Synonym(s):
- SMM cycle
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found
External links
- ARACYC: