Difference between revisions of "H2Othu"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MALSYN-RXN MALSYN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** malate_synthase_g * ec nu...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLCOBALAMIN ADENOSYLCOBALAMIN] == * smiles: ** CC%15(C=C%13(C(N%12(C%14(OC(CO)C(OP([O-])(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLCOBALAMIN ADENOSYLCOBALAMIN] == |
− | * | + | * smiles: |
− | ** | + | ** CC%15(C=C%13(C(N%12(C%14(OC(CO)C(OP([O-])(=O)OC(C)CNC(=O)CCC1(C(CC(N)=O)C2(C4(C)(C(C)(CC(N)=O)C(CCC(=O)N)C3(C(C)=C6(C(CC(=O)N)(C(CCC(N)=O)C5(C=C8(C(C)(C)C(CCC(N)=O)C7(C(C)=C1N2[Co---]([N+]=34)([N+]=56)([N+]=78)(CC9(C(C(O)C(O9)N%10(C=NC%11(C%10=NC=NC=%11N)))O))[N+](=C%12)%13))))C)))))(C))C(O)%14)))=CC(C)=%15)) |
+ | * inchi key: | ||
+ | ** InChIKey=ZIHHMGTYZOSFRC-YGHJOQEPSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** adenosylcobalamin |
− | * | + | * molecular weight: |
− | ** | + | ** 1579.596 |
* Synonym(s): | * Synonym(s): | ||
+ | ** coenzyme B12 | ||
+ | ** cobamide coenzyme | ||
+ | ** deoxyadenosylcobalamin | ||
+ | ** cobamamide | ||
+ | ** vitamin B12 | ||
+ | ** cobamamid | ||
+ | ** 5,6-dimethylbenzimidazolyl-5-deoxyadenosyl-cobamide | ||
+ | ** (5'-deoxy-5'-adenosyl)cobamide coenzyme | ||
+ | ** (5,6-dimethylbenzimidazolyl)cobamide coenzyme | ||
+ | ** 5'-deoxy-5'-adenosylcobalamin | ||
+ | ** 5'-deoxyadenosyl vitamin B12 | ||
+ | ** 5'-deoxyadenosyl-5,6-dimethylbenzimidazolylcobamide | ||
+ | ** 5'-deoxyadenosylcobalamin | ||
+ | ** 5,6-dimethylbenzimidazolyl-Co-5'-deoxyadenosylcobamide | ||
+ | ** calomide | ||
+ | ** cobalamin coenzyme | ||
+ | ** dibencozide | ||
+ | ** funacomide | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-8770]] | |
− | + | * [[COBALADENOSYLTRANS-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[COBALAMINSYN-RXN]] | |
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 13870-90-1 |
− | * | + | * METABOLIGHTS : MTBLC18408 |
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820207 91820207] |
− | + | * HMDB : HMDB02086 | |
− | + | * LIGAND-CPD: | |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00194 C00194] |
− | * | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18408 18408] | |
− | ** [http:// | + | * BIGG : adocbl |
− | * | + | {{#set: smiles=CC%15(C=C%13(C(N%12(C%14(OC(CO)C(OP([O-])(=O)OC(C)CNC(=O)CCC1(C(CC(N)=O)C2(C4(C)(C(C)(CC(N)=O)C(CCC(=O)N)C3(C(C)=C6(C(CC(=O)N)(C(CCC(N)=O)C5(C=C8(C(C)(C)C(CCC(N)=O)C7(C(C)=C1N2[Co---]([N+]=34)([N+]=56)([N+]=78)(CC9(C(C(O)C(O9)N%10(C=NC%11(C%10=NC=NC=%11N)))O))[N+](=C%12)%13))))C)))))(C))C(O)%14)))=CC(C)=%15))}} |
− | ** [http:// | + | {{#set: inchi key=InChIKey=ZIHHMGTYZOSFRC-YGHJOQEPSA-L}} |
− | + | {{#set: common name=adenosylcobalamin}} | |
− | + | {{#set: molecular weight=1579.596 }} | |
− | * | + | {{#set: common name=coenzyme B12|cobamide coenzyme|deoxyadenosylcobalamin|cobamamide|vitamin B12|cobamamid|5,6-dimethylbenzimidazolyl-5-deoxyadenosyl-cobamide|(5'-deoxy-5'-adenosyl)cobamide coenzyme|(5,6-dimethylbenzimidazolyl)cobamide coenzyme|5'-deoxy-5'-adenosylcobalamin|5'-deoxyadenosyl vitamin B12|5'-deoxyadenosyl-5,6-dimethylbenzimidazolylcobamide|5'-deoxyadenosylcobalamin|5,6-dimethylbenzimidazolyl-Co-5'-deoxyadenosylcobamide|calomide|cobalamin coenzyme|dibencozide|funacomide}} |
− | + | {{#set: produced by=RXN-8770|COBALADENOSYLTRANS-RXN}} | |
− | + | {{#set: consumed or produced by=COBALAMINSYN-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 17:24, 10 January 2018
Contents
Metabolite ADENOSYLCOBALAMIN
- smiles:
- CC%15(C=C%13(C(N%12(C%14(OC(CO)C(OP([O-])(=O)OC(C)CNC(=O)CCC1(C(CC(N)=O)C2(C4(C)(C(C)(CC(N)=O)C(CCC(=O)N)C3(C(C)=C6(C(CC(=O)N)(C(CCC(N)=O)C5(C=C8(C(C)(C)C(CCC(N)=O)C7(C(C)=C1N2[Co---]([N+]=34)([N+]=56)([N+]=78)(CC9(C(C(O)C(O9)N%10(C=NC%11(C%10=NC=NC=%11N)))O))[N+](=C%12)%13))))C)))))(C))C(O)%14)))=CC(C)=%15))
- inchi key:
- InChIKey=ZIHHMGTYZOSFRC-YGHJOQEPSA-L
- common name:
- adenosylcobalamin
- molecular weight:
- 1579.596
- Synonym(s):
- coenzyme B12
- cobamide coenzyme
- deoxyadenosylcobalamin
- cobamamide
- vitamin B12
- cobamamid
- 5,6-dimethylbenzimidazolyl-5-deoxyadenosyl-cobamide
- (5'-deoxy-5'-adenosyl)cobamide coenzyme
- (5,6-dimethylbenzimidazolyl)cobamide coenzyme
- 5'-deoxy-5'-adenosylcobalamin
- 5'-deoxyadenosyl vitamin B12
- 5'-deoxyadenosyl-5,6-dimethylbenzimidazolylcobamide
- 5'-deoxyadenosylcobalamin
- 5,6-dimethylbenzimidazolyl-Co-5'-deoxyadenosylcobamide
- calomide
- cobalamin coenzyme
- dibencozide
- funacomide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 13870-90-1
- METABOLIGHTS : MTBLC18408
- PUBCHEM:
- HMDB : HMDB02086
- LIGAND-CPD:
- CHEBI:
- BIGG : adocbl
"CC%15(C=C%13(C(N%12(C%14(OC(CO)C(OP([O-])(=O)OC(C)CNC(=O)CCC1(C(CC(N)=O)C2(C4(C)(C(C)(CC(N)=O)C(CCC(=O)N)C3(C(C)=C6(C(CC(=O)N)(C(CCC(N)=O)C5(C=C8(C(C)(C)C(CCC(N)=O)C7(C(C)=C1N2[Co---]([N+]=34)([N+]=56)([N+]=78)(CC9(C(C(O)C(O9)N%10(C=NC%11(C%10=NC=NC=%11N)))O))[N+](=C%12)%13))))C)))))(C))C(O)%14)))=CC(C)=%15))" cannot be used as a page name in this wiki.