Difference between revisions of "TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Elongation-factor-2-P Elongation-factor-2-P] == * common name: ** phosphorylated elongation-fac...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE SUCROSE] == * smiles: ** C(C2(OC(OC1(OC(CO)C(C(O)1)O)CO)C(C(O)C2O)O))O * inchi key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE SUCROSE] == |
| + | * smiles: | ||
| + | ** C(C2(OC(OC1(OC(CO)C(C(O)1)O)CO)C(C(O)C2O)O))O | ||
| + | * inchi key: | ||
| + | ** InChIKey=CZMRCDWAGMRECN-UGDNZRGBSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** sucrose |
| + | * molecular weight: | ||
| + | ** 342.299 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** saccharose |
| + | ** Glc(α1->2β)Fru | ||
| + | ** β-D-fructofuranosyl-(2↔1)-α-D-glucopyranoside | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[3.2.1.48-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11502]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[2. | + | * [[2.4.1.125-RXN]] |
== External links == | == External links == | ||
| − | {{#set: common name= | + | * NCI: |
| − | {{#set: common name= | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=406942 406942] |
| − | {{#set: consumed or produced by=2. | + | * CAS : 57-50-1 |
| + | * METABOLIGHTS : MTBLC17992 | ||
| + | * DRUGBANK : DB02772 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5988 5988] | ||
| + | * KEGG-GLYCAN : G00370 | ||
| + | * HMDB : HMDB00258 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00089 C00089] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5768.html 5768] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17992 17992] | ||
| + | * BIGG : sucr | ||
| + | {{#set: smiles=C(C2(OC(OC1(OC(CO)C(C(O)1)O)CO)C(C(O)C2O)O))O}} | ||
| + | {{#set: inchi key=InChIKey=CZMRCDWAGMRECN-UGDNZRGBSA-N}} | ||
| + | {{#set: common name=sucrose}} | ||
| + | {{#set: molecular weight=342.299 }} | ||
| + | {{#set: common name=saccharose|Glc(α1->2β)Fru|β-D-fructofuranosyl-(2↔1)-α-D-glucopyranoside}} | ||
| + | {{#set: consumed by=3.2.1.48-RXN}} | ||
| + | {{#set: produced by=RXN-11502}} | ||
| + | {{#set: consumed or produced by=2.4.1.125-RXN}} | ||
Revision as of 16:24, 10 January 2018
Contents
Metabolite SUCROSE
- smiles:
- C(C2(OC(OC1(OC(CO)C(C(O)1)O)CO)C(C(O)C2O)O))O
- inchi key:
- InChIKey=CZMRCDWAGMRECN-UGDNZRGBSA-N
- common name:
- sucrose
- molecular weight:
- 342.299
- Synonym(s):
- saccharose
- Glc(α1->2β)Fru
- β-D-fructofuranosyl-(2↔1)-α-D-glucopyranoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- NCI:
- CAS : 57-50-1
- METABOLIGHTS : MTBLC17992
- DRUGBANK : DB02772
- PUBCHEM:
- KEGG-GLYCAN : G00370
- HMDB : HMDB00258
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : sucr
"Glc(α1->2β)Fru" cannot be used as a page name in this wiki.
