Difference between revisions of "Tiso gene 15154"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12521 CPD-12521] == * smiles: ** C1(O)(C(O)C(O)OC(C(=O)[O-])C(O)1) * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7089 PWY-7089] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7089 PWY-7089] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** taxiphyllin bioactivation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | * '''1''' reaction(s) found | |
− | * | + | ** [[RXN-13600]] |
− | * [[RXN- | + | == Reaction(s) not found == |
− | == Reaction(s) | + | * '''0''' reaction(s) not found |
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-58024}} | |
− | + | {{#set: common name=taxiphyllin bioactivation}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:25, 10 January 2018
Pathway PWY-7089
- taxonomic range:
- common name:
- taxiphyllin bioactivation
- Synonym(s):
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 0 reaction(s) not found