Difference between revisions of "DIACYLGLYCEROL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] == * smiles: ** C(O)C1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=ZZZCUOFIHG...")
 
(Created page with "Category:Gene == Gene Tiso_gene_9534 == * left end position: ** 3140 * transcription direction: ** POSITIVE * right end position: ** 8567 * centisome position: ** 33.91661...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] ==
+
== Gene Tiso_gene_9534 ==
* smiles:
+
* left end position:
** C(O)C1(C(O)=C(O)C(=O)O1)
+
** 3140
* inchi key:
+
* transcription direction:
** InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N
+
** POSITIVE
* common name:
+
* right end position:
** dehydro-D-arabinono-1,4-lactone
+
** 8567
* molecular weight:
+
* centisome position:
** 146.099    
+
** 33.916615    
 
* Synonym(s):
 
* Synonym(s):
** (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one
 
** D-erythro-ascorbic acid
 
** D-erythro-ascorbate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[1.3.99.23-RXN]]
* [[1.1.3.37-RXN]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=3140}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675775 54675775]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=8567}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17803 17803]
+
{{#set: centisome position=33.916615   }}
* LIGAND-CPD:
+
{{#set: reaction associated=1.3.99.23-RXN}}
** [http://www.genome.jp/dbget-bin/www_bget?C06316 C06316]
+
{{#set: smiles=C(O)C1(C(O)=C(O)C(=O)O1)}}
+
{{#set: inchi key=InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N}}
+
{{#set: common name=dehydro-D-arabinono-1,4-lactone}}
+
{{#set: molecular weight=146.099   }}
+
{{#set: common name=(5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one|D-erythro-ascorbic acid|D-erythro-ascorbate}}
+
{{#set: produced by=1.1.3.37-RXN}}
+

Revision as of 16:25, 10 January 2018

Gene Tiso_gene_9534

  • left end position:
    • 3140
  • transcription direction:
    • POSITIVE
  • right end position:
    • 8567
  • centisome position:
    • 33.916615
  • Synonym(s):

Reactions associated

Pathways associated

External links