Difference between revisions of "TRIACYLGLYCEROL-LIPASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_I COPROPORPHYRINOGEN_I] == * smiles: ** CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_I COPROPORPHYRINOGEN_I] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC4(=C(CCC([O-])=O)C(C)=C(CC3(=C(CCC([O-])=O)C(C)=C(CC(=C(CCC([O-])=O)1)N2)N3))N4))N5))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=WIUGGJKHYQIGNH-UHFFFAOYSA-J |
* common name: | * common name: | ||
| − | ** | + | ** coproporphyrinogen I |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 656.734 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-10642]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20849147 20849147] |
| − | {{#set: smiles= | + | * CHEMSPIDER: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.chemspider.com/Chemical-Structure.20171594.html 20171594] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62631 62631] |
| − | {{#set: produced by=RXN- | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05768 C05768] | ||
| + | * HMDB : HMDB02158 | ||
| + | {{#set: smiles=CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC4(=C(CCC([O-])=O)C(C)=C(CC3(=C(CCC([O-])=O)C(C)=C(CC(=C(CCC([O-])=O)1)N2)N3))N4))N5)))}} | ||
| + | {{#set: inchi key=InChIKey=WIUGGJKHYQIGNH-UHFFFAOYSA-J}} | ||
| + | {{#set: common name=coproporphyrinogen I}} | ||
| + | {{#set: molecular weight=656.734 }} | ||
| + | {{#set: consumed or produced by=RXN-10642}} | ||
Revision as of 16:26, 10 January 2018
Contents
Metabolite COPROPORPHYRINOGEN_I
- smiles:
- CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC4(=C(CCC([O-])=O)C(C)=C(CC3(=C(CCC([O-])=O)C(C)=C(CC(=C(CCC([O-])=O)1)N2)N3))N4))N5)))
- inchi key:
- InChIKey=WIUGGJKHYQIGNH-UHFFFAOYSA-J
- common name:
- coproporphyrinogen I
- molecular weight:
- 656.734
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC4(=C(CCC([O-])=O)C(C)=C(CC3(=C(CCC([O-])=O)C(C)=C(CC(=C(CCC([O-])=O)1)N2)N3))N4))N5)))" cannot be used as a page name in this wiki.
