Difference between revisions of "GLYCEROL-KIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6182 RXN-6182] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ident...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12521 CPD-12521] == * smiles: ** C1(O)(C(O)C(O)OC(C(=O)[O-])C(O)1) * inchi key: ** InChIKey...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6182 RXN-6182] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12521 CPD-12521] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C1(O)(C(O)C(O)OC(C(=O)[O-])C(O)1)
 +
* inchi key:
 +
** InChIKey=AEMOLEFTQBMNLQ-QIUUJYRFSA-M
 +
* common name:
 +
** β-D-glucuronate
 +
* molecular weight:
 +
** 193.133   
 
* Synonym(s):
 
* Synonym(s):
 +
** β-D-glucuronic acid
 +
** β-D-glucopyranuronic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[ALPHA-GLC-6-P]][c] '''<=>''' 1.0 [[FRUCTOSE-6P]][c]
+
* [[RXN-15291]]
−
* With common name(s):
+
* [[RXN-15289]]
−
** 1.0 &alpha;-D-glucose 6-phosphate[c] '''<=>''' 1.0 &beta;-D-fructofuranose 6-phosphate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_19480]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[manual]]:
+
−
** [[primary_network]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_19480}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11877136 11877136]
−
{{#set: in pathway=}}
+
* CHEMSPIDER:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.chemspider.com/Chemical-Structure.10051464.html 10051464]
−
{{#set: reconstruction tool=pantograph}}
+
* CHEBI:
−
{{#set: reconstruction source=esiliculosus}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85313 85313]
−
{{#set: reconstruction category=manual}}
+
* METABOLIGHTS : MTBLC28860
−
{{#set: reconstruction source=primary_network}}
+
{{#set: smiles=C1(O)(C(O)C(O)OC(C(=O)[O-])C(O)1)}}
 +
{{#set: inchi key=InChIKey=AEMOLEFTQBMNLQ-QIUUJYRFSA-M}}
 +
{{#set: common name=&beta;-D-glucuronate}}
 +
{{#set: molecular weight=193.133    }}
 +
{{#set: common name=&beta;-D-glucuronic acid|&beta;-D-glucopyranuronic acid}}
 +
{{#set: produced by=RXN-15291|RXN-15289}}

Revision as of 16:26, 10 January 2018

Metabolite CPD-12521

  • smiles:
    • C1(O)(C(O)C(O)OC(C(=O)[O-])C(O)1)
  • inchi key:
    • InChIKey=AEMOLEFTQBMNLQ-QIUUJYRFSA-M
  • common name:
    • β-D-glucuronate
  • molecular weight:
    • 193.133
  • Synonym(s):
    • β-D-glucuronic acid
    • β-D-glucopyranuronic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(O)(C(O)C(O)OC(C(=O)[O-])C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GLYCEROL-KIN-RXN&oldid=12917"