Difference between revisions of "PYRIDOXINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...")
 
(Created page with "Category:Gene == Gene Tiso_gene_15743 == * left end position: ** 756 * transcription direction: ** NEGATIVE * right end position: ** 4752 * centisome position: ** 15.66514...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] ==
+
== Gene Tiso_gene_15743 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
+
** 756
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 1-18:1-2-lysophosphatidylethanolamine
+
** 4752
−
* molecular weight:
+
* centisome position:
−
** 479.593    
+
** 15.665147    
 
* Synonym(s):
 
* Synonym(s):
−
** 1-18:1-lysoPE
 
−
** 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-15035]]
+
* [[RXN-11370]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[RXN-15067]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[esiliculosus]]
−
* [[RXN-15036]]
+
* [[RXN-11373]]
 +
** in-silico_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN-11374]]
 +
** in-silico_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN-14326]]
 +
** in-silico_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6482]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=756}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=58177709 58177709]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=4752}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74971 74971]
+
{{#set: centisome position=15.665147   }}
−
* HMDB : HMDB11506
+
{{#set: reaction associated=RXN-11370|RXN-11373|RXN-11374|RXN-14326}}
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O}}
+
{{#set: pathway associated=PWY-6482}}
−
{{#set: inchi key=InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N}}
+
−
{{#set: common name=1-18:1-2-lysophosphatidylethanolamine}}
+
−
{{#set: molecular weight=479.593   }}
+
−
{{#set: common name=1-18:1-lysoPE|1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
+
−
{{#set: consumed by=RXN-15035}}
+
−
{{#set: produced by=RXN-15067}}
+
−
{{#set: consumed or produced by=RXN-15036}}
+

Revision as of 16:26, 10 January 2018

Gene Tiso_gene_15743

  • left end position:
    • 756
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4752
  • centisome position:
    • 15.665147
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PYRIDOXINE&oldid=12941"