|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTDPGLUCDEHYDRAT-RXN DTDPGLUCDEHYDRAT-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| + | * inchi key: |
| + | ** InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N |
| * common name: | | * common name: |
− | ** aminotransferase_s-adenosyl-l-homocysteine_hydrolase | + | ** 6-hydroxytyphasterol |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/4.2.1.46 EC-4.2.1.46] | + | ** 450.701 |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[DTDP-D-GLUCOSE]][c] '''=>''' 1 [[DTDP-DEOH-DEOXY-GLUCOSE]][c] '''+''' 1 [[WATER]][c]
| + | * [[RXN-4241]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 dTDP-α-D-glucose[c] '''=>''' 1 dTDP-4-dehydro-6-deoxy-α-D-glucopyranose[c] '''+''' 1 H2O[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_7329]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_12394]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways ==
| + | |
− | * [[PWY-7315]], dTDP-N-acetylthomosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7315 PWY-7315]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-7316]], dTDP-N-acetylviosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7316 PWY-7316]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[DTDPRHAMSYN-PWY]], dTDP-L-rhamnose biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=DTDPRHAMSYN-PWY DTDPRHAMSYN-PWY]
| + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-7301]], dTDP-4-O-demethyl-β-L-noviose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7301 PWY-7301]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-7104]], dTDP-L-megosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7104 PWY-7104]
| + | |
− | ** '''2''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-6953]], dTDP-3-acetamido-α-D-fucose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6953 PWY-6953]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-7318]], dTDP-3-acetamido-3,6-dideoxy-α-D-glucose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7318 PWY-7318]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-6942]], dTDP-D-desosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6942 PWY-6942] | + | |
− | ** '''2''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-7312]], dTDP-D-β-fucofuranose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7312 PWY-7312]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-7814]], dTDP-L-daunosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7814 PWY-7814]
| + | |
− | ** '''2''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-7440]], dTDP-β-L-4-epi-vancosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7440 PWY-7440]
| + | |
− | ** '''2''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-7657]], dTDP-β-L-digitoxose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7657 PWY-7657]
| + | |
− | ** '''2''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-6808]], dTDP-D-forosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6808 PWY-6808]
| + | |
− | ** '''2''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-7413]], dTDP-6-deoxy-α-D-allose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7413 PWY-7413]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6976]], dTDP-L-mycarose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6976 PWY-6976]
| + | |
− | ** '''2''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-7688]], dTDP-D-ravidosamine and dTDP-4-acetyl-D-ravidosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7688 PWY-7688]
| + | |
− | ** '''2''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-6974]], dTDP-L-olivose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6974 PWY-6974]
| + | |
− | ** '''2''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-6973]], dTDP-D-olivose, dTDP-D-oliose and dTDP-D-mycarose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6973 PWY-6973]
| + | |
− | ** '''2''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-3221]], dTDP-L-rhamnose biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3221 PWY-3221]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-7414]], dTDP-α-D-mycaminose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7414 PWY-7414]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[synechocystis]]
| + | |
− | *** [[athaliana]]
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17221 17221] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515372 102515372] |
− | * LIGAND-RXN:
| + | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R06513 R06513]
| + | {{#set: inchi key=InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N}} |
− | * UNIPROT:
| + | {{#set: common name=6-hydroxytyphasterol}} |
− | ** [http://www.uniprot.org/uniprot/Q9R5L1 Q9R5L1]
| + | {{#set: molecular weight=450.701 }} |
− | ** [http://www.uniprot.org/uniprot/P44914 P44914]
| + | {{#set: produced by=RXN-4241}} |
− | ** [http://www.uniprot.org/uniprot/P29782 P29782]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27830 P27830]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55294 P55294]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S642 Q9S642]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37759 P37759]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26391 P26391]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59626 Q59626]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39630 P39630]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37777 P37777]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37761 P37761]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q54144 Q54144]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q56173 Q56173]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55420 Q55420]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55293 P55293]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66249 O66249]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RMC4 Q9RMC4]
| + | |
− | ** [http://www.uniprot.org/uniprot/O08246 O08246]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RR28 Q9RR28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SMJ5 Q9SMJ5]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=aminotransferase_s-adenosyl-l-homocysteine_hydrolase}} | + | |
− | {{#set: ec number=EC-4.2.1.46}} | + | |
− | {{#set: gene associated=Tiso_gene_7329|Tiso_gene_12394}} | + | |
− | {{#set: in pathway=PWY-7315|PWY-7316|DTDPRHAMSYN-PWY|PWY-7301|PWY-7104|PWY-6953|PWY-7318|PWY-6942|PWY-7312|PWY-7814|PWY-7440|PWY-7657|PWY-6808|PWY-7413|PWY-6976|PWY-7688|PWY-6974|PWY-6973|PWY-3221|PWY-7414}}
| + | |
− | {{#set: reconstruction category=orthology}}
| + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=synechocystis|athaliana|esiliculosus}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=in-silico_annotation}}
| + | |