Difference between revisions of "RXN-16425"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDRh GDRh] == * direction: ** LEFT-TO-RIGHT * common name: ** glutathione-disulfide reductase, chlo...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDRh GDRh] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
 +
* inchi key:
 +
** InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
 
* common name:
 
* common name:
−
** glutathione-disulfide reductase, chloroplast
+
** 1-18:1-2-lysophosphatidylethanolamine
 +
* molecular weight:
 +
** 479.593   
 
* Synonym(s):
 
* Synonym(s):
 +
** 1-18:1-lysoPE
 +
** 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-15035]]
−
** 1.0 [[NADH]][h] '''+''' 1.0 [[PROTON]][h] '''+''' 1.0 [[OXIDIZED-GLUTATHIONE]][h] '''=>''' 2.0 [[GLUTATHIONE]][h] '''+''' 1.0 [[NAD]][h]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-15067]]
−
** 1.0 NADH[h] '''+''' 1.0 H+[h] '''+''' 1.0 glutathione disulfide[h] '''=>''' 2.0 glutathione[h] '''+''' 1.0 NAD+[h]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN-15036]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_12533]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_2804]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=glutathione-disulfide reductase, chloroplast}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=58177709 58177709]
−
{{#set: gene associated=Tiso_gene_12533|Tiso_gene_2804}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74971 74971]
−
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB11506
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O}}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: inchi key=InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N}}
 +
{{#set: common name=1-18:1-2-lysophosphatidylethanolamine}}
 +
{{#set: molecular weight=479.593    }}
 +
{{#set: common name=1-18:1-lysoPE|1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
 +
{{#set: consumed by=RXN-15035}}
 +
{{#set: produced by=RXN-15067}}
 +
{{#set: consumed or produced by=RXN-15036}}

Revision as of 16:27, 10 January 2018

Metabolite CPD-8355

  • smiles:
    • CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
  • inchi key:
    • InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
  • common name:
    • 1-18:1-2-lysophosphatidylethanolamine
  • molecular weight:
    • 479.593
  • Synonym(s):
    • 1-18:1-lysoPE
    • 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16425&oldid=13010"