Difference between revisions of "Tiso gene 12434"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13560 == * left end position: ** 3676 * transcription direction: ** POSITIVE * right end position: ** 5777 * centisome position: ** 59.0711...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CONIFERALDEHYDE 5-HYDROXY-CONIFERALDEHYDE] == * smiles: ** COC1(=CC(C=CC=O)=CC(O)=C(O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CONIFERALDEHYDE 5-HYDROXY-CONIFERALDEHYDE] == |
− | * | + | * smiles: |
− | ** | + | ** COC1(=CC(C=CC=O)=CC(O)=C(O)1) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=IEHPLRVWOHZKCS-NSCUHMNNSA-N |
− | * | + | * common name: |
− | ** | + | ** 5-hydroxy-coniferaldehyde |
− | * | + | * molecular weight: |
− | ** | + | ** 194.187 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-1143]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282094 5282094] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4445308.html 4445308] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31134 31134] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C12204 C12204] | ||
+ | {{#set: smiles=COC1(=CC(C=CC=O)=CC(O)=C(O)1)}} | ||
+ | {{#set: inchi key=InChIKey=IEHPLRVWOHZKCS-NSCUHMNNSA-N}} | ||
+ | {{#set: common name=5-hydroxy-coniferaldehyde}} | ||
+ | {{#set: molecular weight=194.187 }} | ||
+ | {{#set: consumed by=RXN-1143}} |
Revision as of 16:27, 10 January 2018
Contents
Metabolite 5-HYDROXY-CONIFERALDEHYDE
- smiles:
- COC1(=CC(C=CC=O)=CC(O)=C(O)1)
- inchi key:
- InChIKey=IEHPLRVWOHZKCS-NSCUHMNNSA-N
- common name:
- 5-hydroxy-coniferaldehyde
- molecular weight:
- 194.187
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links