Difference between revisions of "RXN-13001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R94 R94] == * direction: ** LEFT-TO-RIGHT * common name: ** R94 * Synonym(s): == Reaction Formula...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R94 R94] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** R94 |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | == | + | ** 1.0 [[NADP]][c] '''+''' 1.0 [[CPD-7408]][c] '''=>''' 1.0 [[CPD1F-98]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADPH]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1.0 NADP+[c] '''+''' 1.0 all-trans phytofluene[c] '''=>''' 1.0 all-trans-ζ-carotene[c] '''+''' 1.0 H+[c] '''+''' 1.0 NADPH[c] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_3579]] | ||
| + | ** [[pantograph]]-[[synechocystis]] | ||
| + | * [[Tiso_gene_2193]] | ||
| + | ** [[pantograph]]-[[synechocystis]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[synechocystis]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=R94}} | |
| − | + | {{#set: gene associated=Tiso_gene_3579|Tiso_gene_2193}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=synechocystis}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 17:27, 10 January 2018
Contents
Reaction R94
- direction:
- LEFT-TO-RIGHT
- common name:
- R94
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 NADP+[c] + 1.0 all-trans phytofluene[c] => 1.0 all-trans-ζ-carotene[c] + 1.0 H+[c] + 1.0 NADPH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
