Difference between revisions of "CPD-11408"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALACETIC_ACID OXALACETIC_ACID] == * smiles: ** C(C([O-])=O)C(=O)C([O-])=O * inchi key: ** InC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13001 RXN-13001] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13001 RXN-13001] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.2.1.134 EC-4.2.1.134] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-14419]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-14420]][c] |
− | + | * With common name(s): | |
− | + | ** 1 3R-hydroxy-icosatrienoyl-CoA[c] '''=>''' 1 H2O[c] '''+''' 1 icosatrienoyl-2-enoyl CoA[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | * [ | + | == Pathways == |
− | + | * [[PWY-7602]], icosapentaenoate biosynthesis V (8-desaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7602 PWY-7602] | |
− | * [[ | + | ** '''7''' reactions found over '''7''' reactions in the full pathway |
− | + | * [[PWY-7619]], juniperonate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7619 PWY-7619] | |
− | * [[ | + | ** '''4''' reactions found over '''5''' reactions in the full pathway |
− | * [[ | + | * [[PWY-7724]], icosapentaenoate biosynthesis III (8-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7724 PWY-7724] |
− | * [[ | + | ** '''5''' reactions found over '''7''' reactions in the full pathway |
− | * [[ | + | == Reconstruction information == |
− | * [[ | + | * [[annotation]]: |
+ | ** [[pathwaytools]]: | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-4.2.1.134}} | |
− | + | {{#set: in pathway=PWY-7602|PWY-7619|PWY-7724}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | {{#set: reconstruction source=in-silico_annotation}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:27, 10 January 2018
Contents
Reaction RXN-13001
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 3R-hydroxy-icosatrienoyl-CoA[c] => 1 H2O[c] + 1 icosatrienoyl-2-enoyl CoA[c]
Genes associated with this reaction
Pathways
- PWY-7602, icosapentaenoate biosynthesis V (8-desaturase, lower eukaryotes): PWY-7602
- 7 reactions found over 7 reactions in the full pathway
- PWY-7619, juniperonate biosynthesis: PWY-7619
- 4 reactions found over 5 reactions in the full pathway
- PWY-7724, icosapentaenoate biosynthesis III (8-desaturase, mammals): PWY-7724
- 5 reactions found over 7 reactions in the full pathway