Difference between revisions of "PWY-5677"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15065 RXN-15065] == * direction: ** LEFT-TO-RIGHT * common name: ** phospholipase A2 ** abhydro...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * smiles: ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15065 RXN-15065] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
 +
* inchi key:
 +
** InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
 
* common name:
 
* common name:
−
** phospholipase A2
+
** GDP-β-L-fucose
−
** abhydrolase_domain-containing_protein_4-like
+
* molecular weight:
−
** ORF
+
** 587.33   
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/3.1.1.4 EC-3.1.1.4]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[1-2-DIPALMITOYLPHOSPHATIDYLCHOLINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PALMITATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-8343]][c]
+
* [[1.1.1.271-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 1,2-dipalmitoyl-phosphatidylcholine[c] '''+''' 1 H2O[c] '''=>''' 1 palmitate[c] '''+''' 1 H+[c] '''+''' 1 1-16:0-2-lysophosphatidylcholine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_12959]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_15047]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_12960]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_15046]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7416]], phospholipid remodeling (phosphatidylcholine, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7416 PWY-7416]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=phospholipase A2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244478 25244478]
−
{{#set: common name=abhydrolase_domain-containing_protein_4-like}}
+
* CHEBI:
−
{{#set: common name=ORF}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57273 57273]
−
{{#set: ec number=EC-3.1.1.4}}
+
{{#set: smiles=CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)}}
−
{{#set: gene associated=Tiso_gene_12959|Tiso_gene_15047|Tiso_gene_12960|Tiso_gene_15046}}
+
{{#set: inchi key=InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L}}
−
{{#set: in pathway=PWY-7416}}
+
{{#set: common name=GDP-β-L-fucose}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=587.33    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: produced by=1.1.1.271-RXN}}
−
{{#set: reconstruction source=in-silico_annotation}}
+

Revision as of 17:28, 10 January 2018

Metabolite CPD-13118

  • smiles:
    • CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
  • inchi key:
    • InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
  • common name:
    • GDP-β-L-fucose
  • molecular weight:
    • 587.33
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5677&oldid=13082"