Difference between revisions of "CPD-10284"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] == * smiles: ** [CH](=O)C(O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=LXJXRIRHZLFYRP-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-Delta5-dodecenoyl-ACPs Cis-Delta5-dodecenoyl-ACPs] == * common name: ** a (5Z)-dodec-5-enoy...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-Delta5-dodecenoyl-ACPs Cis-Delta5-dodecenoyl-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a (5Z)-dodec-5-enoyl-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a cis-Δ5-dodecenoyl-[acp] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10654]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-2145]] |
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a (5Z)-dodec-5-enoyl-[acp]}} | |
| − | + | {{#set: common name=a cis-Δ5-dodecenoyl-[acp]}} | |
| − | + | {{#set: consumed by=RXN-10654}} | |
| − | + | {{#set: produced by=RXN0-2145}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 16:31, 10 January 2018
Contents
Metabolite Cis-Delta5-dodecenoyl-ACPs
- common name:
- a (5Z)-dodec-5-enoyl-[acp]
- Synonym(s):
- a cis-Δ5-dodecenoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a (5Z)-dodec-5-enoyl-[acp" cannot be used as a page name in this wiki.
"a cis-Δ5-dodecenoyl-[acp" cannot be used as a page name in this wiki.
