Difference between revisions of "PWY-6406"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] == * smiles: ** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-249 TRANS-RXN-249] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-249 TRANS-RXN-249] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
* inchi key:
+
** InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J
+
* common name:
+
** (2E,7Z)-tetradecenoyl-CoA
+
* molecular weight:
+
** 969.83   
+
 
* Synonym(s):
 
* Synonym(s):
** 14:2-Δ2,Δ7-CoA
 
** 2-trans,7-cis-tetradecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17793]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 4.0 [[PROTON]][c] '''+''' 1.0 [[ATP]][c] '''+''' 1.0 [[WATER]][c] '''<=>''' 1.0 [[ADP]][c] '''+''' 1.0 [[Pi]][c] '''+''' 5.0 [[PROTON]][e]
* [[RXN-17792]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 4.0 H+[c] '''+''' 1.0 ATP[c] '''+''' 1.0 H2O[c] '''<=>''' 1.0 ADP[c] '''+''' 1.0 phosphate[c] '''+''' 5.0 H+[e]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_1366]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=REVERSIBLE}}
{{#set: inchi key=InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J}}
+
{{#set: gene associated=Tiso_gene_1366}}
{{#set: common name=(2E,7Z)-tetradecenoyl-CoA}}
+
{{#set: in pathway=}}
{{#set: molecular weight=969.83    }}
+
{{#set: reconstruction category=orthology}}
{{#set: common name=14:2-&Delta;2,&Delta;7-CoA|2-trans,7-cis-tetradecenoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: consumed by=RXN-17793}}
+
{{#set: reconstruction source=esiliculosus}}
{{#set: produced by=RXN-17792}}
+

Revision as of 16:31, 10 January 2018

Reaction TRANS-RXN-249

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 4.0 H+[c] + 1.0 ATP[c] + 1.0 H2O[c] <=> 1.0 ADP[c] + 1.0 phosphate[c] + 5.0 H+[e]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links