Difference between revisions of "RXN-8629"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Methionylaminoacyl-tRNAs L-Methionylaminoacyl-tRNAs] == * common name: ** a L-methionylaminoa...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-6-SOLANYL-14-BENZOQUINONE 2-METHYL-6-SOLANYL-14-BENZOQUINONE] == * smiles: ** CC(=CCCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-6-SOLANYL-14-BENZOQUINONE 2-METHYL-6-SOLANYL-14-BENZOQUINONE] == |
| + | * smiles: | ||
| + | ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCC1(=C(O)C(C)=CC(O)=C1))C)C)C)C | ||
| + | * inchi key: | ||
| + | ** InChIKey=SWKACZQJGXABCN-JSGWLJPKSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol |
| + | * molecular weight: | ||
| + | ** 737.203 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** MSBQ | ||
| + | ** 2-methyl-6-solanesyl-1,4-benzoquinol | ||
| + | ** 2-methyl-6--all-trans-nonaprenyl-benzene-1,4-diol | ||
| + | ** 2-methyl-6-solanyl-1,4-benzoquinol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-2762]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[R600]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237185 44237185] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75402 75402] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C17570 C17570] | ||
| + | {{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCC1(=C(O)C(C)=CC(O)=C1))C)C)C)C}} | ||
| + | {{#set: inchi key=InChIKey=SWKACZQJGXABCN-JSGWLJPKSA-N}} | ||
| + | {{#set: common name=2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol}} | ||
| + | {{#set: molecular weight=737.203 }} | ||
| + | {{#set: common name=MSBQ|2-methyl-6-solanesyl-1,4-benzoquinol|2-methyl-6--all-trans-nonaprenyl-benzene-1,4-diol|2-methyl-6-solanyl-1,4-benzoquinol}} | ||
| + | {{#set: consumed by=RXN-2762}} | ||
| + | {{#set: produced by=R600}} | ||
Revision as of 16:31, 10 January 2018
Contents
Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE
- smiles:
- CC(=CCCC(C)=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCC1(=C(O)C(C)=CC(O)=C1))C)C)C)C
- inchi key:
- InChIKey=SWKACZQJGXABCN-JSGWLJPKSA-N
- common name:
- 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
- molecular weight:
- 737.203
- Synonym(s):
- MSBQ
- 2-methyl-6-solanesyl-1,4-benzoquinol
- 2-methyl-6--all-trans-nonaprenyl-benzene-1,4-diol
- 2-methyl-6-solanyl-1,4-benzoquinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
