Difference between revisions of "Tiso gene 1011"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_13369 == * left end position: ** 3958 * transcription direction: ** POSITIVE * right end position: ** 4659 * centisome position: ** 62.3601...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] ==
+
== Gene Tiso_gene_13369 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 3958
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** phytenoyl-CoA
+
** 4659
−
* molecular weight:
+
* centisome position:
−
** 1056.006    
+
** 62.36017    
 
* Synonym(s):
 
* Synonym(s):
−
** E-phytenoyl-CoA
 
−
** trans-phytenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-482]]
+
* [[1.3.99.23-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[RXN66-480]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
* [[R95]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[R96]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[RXN-8042]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6475]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3958}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657969 90657969]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: right end position=4659}}
−
{{#set: inchi key=InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J}}
+
{{#set: centisome position=62.36017   }}
−
{{#set: common name=phytenoyl-CoA}}
+
{{#set: reaction associated=1.3.99.23-RXN|R95|R96|RXN-8042}}
−
{{#set: molecular weight=1056.006   }}
+
{{#set: pathway associated=PWY-6475}}
−
{{#set: common name=E-phytenoyl-CoA|trans-phytenoyl-CoA}}
+
−
{{#set: consumed by=RXN66-482}}
+
−
{{#set: produced by=RXN66-480}}
+

Revision as of 16:35, 10 January 2018

Gene Tiso_gene_13369

  • left end position:
    • 3958
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4659
  • centisome position:
    • 62.36017
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1011&oldid=13637"