Difference between revisions of "Tiso gene 3200"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == * smiles: ** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta13-3-hydroxylacceroyl-ACPs cis-delta13-3-hydroxylacceroyl-ACPs] == * common name: ** a...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta13-3-hydroxylacceroyl-ACPs cis-delta13-3-hydroxylacceroyl-ACPs] ==
−
* smiles:
+
−
** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
+
−
* inchi key:
+
−
** InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J
+
 
* common name:
 
* common name:
−
** dUTP
+
** a cis-delta13-3-hydroxyC32:1-[acp]
−
* molecular weight:
+
−
** 464.112   
+
 
* Synonym(s):
 
* Synonym(s):
−
** deoxy-UTP
 
−
** 2'-deoxyuridine-5'-triphosphate
 
−
** deoxyuridine-triphosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-14199]]
 
−
* [[DUTUP]]
 
−
* [[DUTCP]]
 
−
* [[DUTNH]]
 
−
* [[RXN-14219]]
 
−
* [[DUTP-PYROP-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[ATDUDm]]
+
* [[RXN1G-260]]
−
* [[ATDUD]]
+
−
* [[DUDPKIN-RXN]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 1173-82-6
+
{{#set: common name=a cis-delta13-3-hydroxyC32:1-[acp]}}
−
* PUBCHEM:
+
{{#set: produced by=RXN1G-260}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244408 25244408]
+
−
* HMDB : HMDB01191
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00460 C00460]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61555 61555]
+
−
* BIGG : dutp
+
−
{{#set: smiles=C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}}
+
−
{{#set: inchi key=InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J}}
+
−
{{#set: common name=dUTP}}
+
−
{{#set: molecular weight=464.112    }}
+
−
{{#set: common name=deoxy-UTP|2'-deoxyuridine-5'-triphosphate|deoxyuridine-triphosphate}}
+
−
{{#set: consumed by=RXN-14199|DUTUP|DUTCP|DUTNH|RXN-14219|DUTP-PYROP-RXN}}
+
−
{{#set: produced by=ATDUDm|ATDUD|DUDPKIN-RXN}}
+

Revision as of 17:35, 10 January 2018

Metabolite cis-delta13-3-hydroxylacceroyl-ACPs

  • common name:
    • a cis-delta13-3-hydroxyC32:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta13-3-hydroxyC32:1-[acp" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3200&oldid=13639"