Difference between revisions of "Dihydro-Lipoyl-Proteins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_9976 == * left end position: ** 7799 * transcription direction: ** NEGATIVE * right end position: ** 8794 * centisome position: ** 87.21762...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_9976 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] ==
−
* left end position:
+
* smiles:
−
** 7799
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** chlorophyll a
−
* right end position:
+
* molecular weight:
−
** 8794
+
** 892.495    
−
* centisome position:
+
−
** 87.21762    
+
 
* Synonym(s):
 
* Synonym(s):
 +
** chlorophyll a (phytol)
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
* [[RME294]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN-17428]]
−
== Pathways associated ==
+
* [[R06284]]
 +
* [[RXN-7666]]
 +
== Reaction(s) of unknown directionality ==
 +
* [[RXN1F-66]]
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=7799}}
+
* CAS : 479-61-8
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=8794}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657767 90657767]
−
{{#set: centisome position=87.21762    }}
+
* KNAPSACK : C00001528
−
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
+
* HMDB : HMDB38578
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05306 C05306]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58416 58416]
 +
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
 +
{{#set: common name=chlorophyll a}}
 +
{{#set: molecular weight=892.495    }}
 +
{{#set: common name=chlorophyll a (phytol)}}
 +
{{#set: consumed by=RME294}}
 +
{{#set: produced by=RXN-17428|R06284|RXN-7666}}
 +
{{#set: consumed or produced by=RXN1F-66}}

Revision as of 16:35, 10 January 2018

Metabolite CHLOROPHYLL-A

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • chlorophyll a
  • molecular weight:
    • 892.495
  • Synonym(s):
    • chlorophyll a (phytol)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 479-61-8
  • PUBCHEM:
  • KNAPSACK : C00001528
  • HMDB : HMDB38578
  • LIGAND-CPD:
  • CHEBI:
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Dihydro-Lipoyl-Proteins&oldid=13659"