Difference between revisions of "RXN-14278"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-576 RXN66-576] == * direction: ** LEFT-TO-RIGHT * common name: ** dimethylglycine_dehydrogena...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-576 RXN66-576] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
 +
* inchi key:
 +
** InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** dimethylglycine_dehydrogenase
+
** N-acetyl-serotonin sulfate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.5.8 EC-1.5.8]
+
** 297.305   
 
* Synonym(s):
 
* Synonym(s):
 +
** N-acetyl-5-hydroxytryptamine sulfate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[DIMETHYL-GLYCINE]][c] '''+''' 1 [[THF-GLU-N]][c] '''+''' 2 [[ETF-Oxidized]][c] '''+''' 3 [[PROTON]][c] '''=>''' 1 [[5-10-METHENYL-THF-GLU-N]][c] '''+''' 2 [[ETF-Reduced]][c] '''+''' 1 [[SARCOSINE]][c]
+
* [[RXN-11059]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 dimethylglycine[c] '''+''' 1 a tetrahydrofolate[c] '''+''' 2 an oxidized electron-transfer flavoprotein[c] '''+''' 3 H+[c] '''=>''' 1 a 5,10-methenyltetrahydrofolate[c] '''+''' 2 a reduced electron-transfer flavoprotein[c] '''+''' 1 sarcosine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_2717]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-3661-1]], glycine betaine degradation II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661-1 PWY-3661-1]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=dimethylglycine_dehydrogenase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514958 102514958]
−
{{#set: ec number=EC-1.5.8}}
+
* HMDB : HMDB60834
−
{{#set: gene associated=Tiso_gene_2717}}
+
{{#set: smiles=CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))}}
−
{{#set: in pathway=PWY-3661-1}}
+
{{#set: inchi key=InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=N-acetyl-serotonin sulfate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=297.305    }}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: common name=N-acetyl-5-hydroxytryptamine sulfate}}
 +
{{#set: produced by=RXN-11059}}

Revision as of 16:35, 10 January 2018

Metabolite CPD-12017

  • smiles:
    • CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
  • inchi key:
    • InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
  • common name:
    • N-acetyl-serotonin sulfate
  • molecular weight:
    • 297.305
  • Synonym(s):
    • N-acetyl-5-hydroxytryptamine sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14278&oldid=13677"