Difference between revisions of "PWY-5340"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYCLOEUCALENOL-CYCLOISOMERASE-RXN CYCLOEUCALENOL-CYCLOISOMERASE-RXN] == * direction: ** LEFT-TO-RIG...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] == * smiles: ** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
| + | * inchi key: | ||
| + | ** InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** (5Z)-tetradecenoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 971.845 |
* Synonym(s): | * Synonym(s): | ||
| + | ** cis-tetradec-5-enoyl-CoA | ||
| + | ** 14:1 cis-5 | ||
| + | ** 14:1(n-9) | ||
| + | ** (5Z)-tetradec-5-enoyl-CoA | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-14576]] | |
| − | + | * [[RXN-17783]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-17782]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659071 90659071] |
| − | * | + | * CHEBI: |
| − | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84650 84650] |
| − | {{#set: | + | {{#set: smiles=CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
| − | + | {{#set: inchi key=InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J}} | |
| − | + | {{#set: common name=(5Z)-tetradecenoyl-CoA}} | |
| − | + | {{#set: molecular weight=971.845 }} | |
| − | {{#set: | + | {{#set: common name=cis-tetradec-5-enoyl-CoA|14:1 cis-5|14:1(n-9)|(5Z)-tetradec-5-enoyl-CoA}} |
| − | {{#set: | + | {{#set: consumed by=RXN-14576|RXN-17783}} |
| − | {{#set: | + | {{#set: produced by=RXN-17782}} |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:35, 10 January 2018
Contents
Metabolite CPD-15436
- smiles:
- CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J
- common name:
- (5Z)-tetradecenoyl-CoA
- molecular weight:
- 971.845
- Synonym(s):
- cis-tetradec-5-enoyl-CoA
- 14:1 cis-5
- 14:1(n-9)
- (5Z)-tetradec-5-enoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.
