Difference between revisions of "PWY-6154"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1544 PWY0-1544] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1544 PWY0-1544] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** proline to cytochrome bo oxidase electron transfer |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''1''' reaction(s) found |
− | == Reaction(s) | + | ** [[RXN0-7008]] |
− | + | == Reaction(s) not found == | |
+ | * '''1''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5268 RXN0-5268] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1544 PWY0-1544] | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
− | + | {{#set: common name=proline to cytochrome bo oxidase electron transfer}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=1}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:36, 10 January 2018
Pathway PWY0-1544
- taxonomic range:
- common name:
- proline to cytochrome bo oxidase electron transfer
- Synonym(s):
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found
External links
- ECOCYC: