Difference between revisions of "HACD5"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine65 tRNA-pseudouridine65] == * common name: ** a pseudouridine65 in tRNA * Syn...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine65 tRNA-pseudouridine65] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] ==
 +
* smiles:
 +
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
 +
* inchi key:
 +
** InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L
 
* common name:
 
* common name:
** a pseudouridine65 in tRNA
+
** D-arabinofuranose 5-phosphate
 +
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** D-arabinofuranose 5P
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[KDO-8PSYNTH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11840]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a pseudouridine65 in tRNA}}
+
* PUBCHEM:
{{#set: produced by=RXN-11840}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91825727 91825727]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85971 85971]
 +
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
 +
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L}}
 +
{{#set: common name=D-arabinofuranose 5-phosphate}}
 +
{{#set: molecular weight=228.095    }}
 +
{{#set: common name=D-arabinofuranose 5P}}
 +
{{#set: consumed by=KDO-8PSYNTH-RXN}}

Revision as of 16:36, 10 January 2018

Metabolite CPD-18118

  • smiles:
    • C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
  • inchi key:
    • InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L
  • common name:
    • D-arabinofuranose 5-phosphate
  • molecular weight:
    • 228.095
  • Synonym(s):
    • D-arabinofuranose 5P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.