Difference between revisions of "PRAISOM-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-299 RXN0-299] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha-ketoglutarate-dependent...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] == * smiles: ** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O * inchi key: ** InChI...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-299 RXN0-299] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O
 +
* inchi key:
 +
** InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L
 
* common name:
 
* common name:
−
** alpha-ketoglutarate-dependent_taurine_dioxygenase
+
** 2-carboxy-L-threo-pentonate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.14.11.17 EC-1.14.11.17]
+
** 208.124   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-carboxy-L-xylonate
 +
** 2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[TAURINE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[SUC]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[SO3]][c] '''+''' 1 [[CPD-1772]][c]
+
* [[RXN-12871]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 taurine[c] '''+''' 1 2-oxoglutarate[c] '''+''' 1 oxygen[c] '''=>''' 1 succinate[c] '''+''' 1 H+[c] '''+''' 1 CO2[c] '''+''' 1 sulfite[c] '''+''' 1 2-aminoacetaldehyde[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_17672]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY0-981]], taurine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-981 PWY0-981]
+
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15909 15909]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657336 90657336]
−
* LIGAND-RXN:
+
{{#set: smiles=C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R05320 R05320]
+
{{#set: inchi key=InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=2-carboxy-L-threo-pentonate}}
−
{{#set: common name=alpha-ketoglutarate-dependent_taurine_dioxygenase}}
+
{{#set: molecular weight=208.124    }}
−
{{#set: ec number=EC-1.14.11.17}}
+
{{#set: common name=2-carboxy-L-xylonate|2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate}}
−
{{#set: gene associated=Tiso_gene_17672}}
+
{{#set: produced by=RXN-12871}}
−
{{#set: in pathway=PWY0-981}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Revision as of 16:37, 10 January 2018

Metabolite CPD-13912

  • smiles:
    • C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O
  • inchi key:
    • InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L
  • common name:
    • 2-carboxy-L-threo-pentonate
  • molecular weight:
    • 208.124
  • Synonym(s):
    • 2-carboxy-L-xylonate
    • 2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PRAISOM-RXN&oldid=13828"