Difference between revisions of "RXN-11373"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-NITROPHENOL P-NITROPHENOL] == * smiles: ** C1(C=C([O-])C=CC=1[N+](=O)[O-]) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Tiso_gene_4806 == * left end position: ** 10343 * transcription direction: ** POSITIVE * right end position: ** 11452 * centisome position: ** 39.594...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4806 == |
− | * | + | * left end position: |
− | ** | + | ** 10343 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 11452 |
− | * | + | * centisome position: |
− | ** | + | ** 39.59498 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN-5061]] | |
− | * [[ | + | ** experimental_annotation |
− | * | + | ***ec-number |
− | * | + | == Pathways associated == |
− | * [[ | + | * [[PWY-2201]] |
− | * [[ | + | * [[CODH-PWY]] |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=10343}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=11452}} | |
− | + | {{#set: centisome position=39.59498 }} | |
− | + | {{#set: reaction associated=RXN-5061}} | |
− | + | {{#set: pathway associated=PWY-2201|CODH-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:38, 10 January 2018
Gene Tiso_gene_4806
- left end position:
- 10343
- transcription direction:
- POSITIVE
- right end position:
- 11452
- centisome position:
- 39.59498
- Synonym(s):
Reactions associated
- RXN-5061
- experimental_annotation
- ec-number
- experimental_annotation