Difference between revisions of "Tiso gene 6738"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7049 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-esiliculosus == Pathways associated == ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] == * smiles: ** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] == |
+ | * smiles: | ||
+ | ** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4) | ||
+ | * inchi key: | ||
+ | ** InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N | ||
+ | * common name: | ||
+ | ** 9-cis-violaxanthin | ||
+ | * molecular weight: | ||
+ | ** 600.88 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 9-c-violaxanthin | ||
+ | ** 9cViol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-7974]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282218 5282218] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35305 35305] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C13433 C13433] | ||
+ | {{#set: smiles=CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}} | ||
+ | {{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N}} | ||
+ | {{#set: common name=9-cis-violaxanthin}} | ||
+ | {{#set: molecular weight=600.88 }} | ||
+ | {{#set: common name=9-c-violaxanthin|9cViol}} | ||
+ | {{#set: consumed by=RXN-7974}} |
Revision as of 16:40, 10 January 2018
Contents
Metabolite CPD-7196
- smiles:
- CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
- inchi key:
- InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N
- common name:
- 9-cis-violaxanthin
- molecular weight:
- 600.88
- Synonym(s):
- 9-c-violaxanthin
- 9cViol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links