Difference between revisions of "PWY-5367"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_43 == * Synonym(s): == Reactions associated == * DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN ** pantograph-athaliana ** pantograph-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_43 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] |
| − | + | ** [[pantograph]]-[[athaliana]] | |
| − | * [[RXN- | + | ** [[pantograph]]-[[esiliculosus]] |
| − | == | + | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] |
| + | ** [[pantograph]]-[[athaliana]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY-7539]] | ||
| + | * [[PWY-6797]] | ||
| + | * [[PWY-6147]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN|H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN}} | |
| − | + | {{#set: pathway associated=PWY-7539|PWY-6797|PWY-6147}} | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 16:41, 10 January 2018
Gene Tiso_gene_43
- Synonym(s):
