Difference between revisions of "ASPARAGINE-DEG1-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] == * smiles: ** C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS * inchi key: ** InChIKey...")
 
(Created page with "Category:Gene == Gene Tiso_gene_17030 == * left end position: ** 408 * transcription direction: ** POSITIVE * right end position: ** 1970 * centisome position: ** 10.29003...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] ==
+
== Gene Tiso_gene_17030 ==
−
* smiles:
+
* left end position:
−
** C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS
+
** 408
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RJCJWONCSKSHES-VIFPVBQESA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** S-succinyl-dihydrolipoamide
+
** 1970
−
* molecular weight:
+
* centisome position:
−
** 306.414    
+
** 10.290038    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-15556]]
−
== Reaction(s) of unknown directionality ==
+
** in-silico_annotation
−
* [[AKGDHe2r]]
+
***ec-number
 +
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=408}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657579 90657579]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1970}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17432 17432]
+
{{#set: centisome position=10.290038    }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01169 C01169]
+
{{#set: pathway associated=PWY-7511}}
−
* HMDB : HMDB01177
+
−
{{#set: smiles=C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS}}
+
−
{{#set: inchi key=InChIKey=RJCJWONCSKSHES-VIFPVBQESA-M}}
+
−
{{#set: common name=S-succinyl-dihydrolipoamide}}
+
−
{{#set: molecular weight=306.414    }}
+
−
{{#set: consumed or produced by=AKGDHe2r}}
+

Revision as of 16:42, 10 January 2018

Gene Tiso_gene_17030

  • left end position:
    • 408
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1970
  • centisome position:
    • 10.290038
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ASPARAGINE-DEG1-PWY&oldid=14208"