Difference between revisions of "Tiso gene 9236"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-] * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == |
* smiles: | * smiles: | ||
− | ** C(O) | + | ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** | + | ** cyclic-2,3-O-oxalyl-L-threonate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 189.101 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2,3-cyclic oxalyl theronolactone |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12872]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12869]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659383 90659383] |
− | + | {{#set: smiles=C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)}} | |
− | + | {{#set: inchi key=InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M}} | |
− | + | {{#set: common name=cyclic-2,3-O-oxalyl-L-threonate}} | |
− | + | {{#set: molecular weight=189.101 }} | |
− | {{#set: smiles=C(O) | + | {{#set: common name=2,3-cyclic oxalyl theronolactone}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: consumed by=RXN-12872}} |
− | {{#set: common name= | + | {{#set: produced by=RXN-12869}} |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 16:43, 10 January 2018
Contents
Metabolite CPD-13914
- smiles:
- C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)
- inchi key:
- InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M
- common name:
- cyclic-2,3-O-oxalyl-L-threonate
- molecular weight:
- 189.101
- Synonym(s):
- 2,3-cyclic oxalyl theronolactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)" cannot be used as a page name in this wiki.