Difference between revisions of "DERMATAN-L-IDURONATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLEIC_ACID LINOLEIC_ACID] == * smiles: ** CCCCCC=CCC=CCCCCCCCC([O-])=O * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Tiso_gene_10792 == * left end position: ** 3707 * transcription direction: ** POSITIVE * right end position: ** 5834 * centisome position: ** 44.7219...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10792 == |
− | * | + | * left end position: |
− | ** | + | ** 3707 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5834 |
− | * | + | * centisome position: |
− | ** | + | ** 44.72192 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[2.7.11.24-RXN]] |
− | + | ** in-silico_annotation | |
− | + | ***automated-name-match | |
− | * | + | == Pathways associated == |
− | * | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=3707}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5834}} | |
− | + | {{#set: centisome position=44.72192 }} | |
− | + | {{#set: reaction associated=2.7.11.24-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 16:43, 10 January 2018
Gene Tiso_gene_10792
- left end position:
- 3707
- transcription direction:
- POSITIVE
- right end position:
- 5834
- centisome position:
- 44.72192
- Synonym(s):
Reactions associated
- 2.7.11.24-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation