Difference between revisions of "RXN-37"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5298 PWY-5298] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] == * smiles: ** C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS * inchi key: ** InChIKey...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS |
| − | ** | + | * inchi key: |
| + | ** InChIKey=RJCJWONCSKSHES-VIFPVBQESA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** S-succinyl-dihydrolipoamide |
| + | * molecular weight: | ||
| + | ** 306.414 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[AKGDHe2r]] | |
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657579 90657579] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17432 17432] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01169 C01169] | ||
| + | * HMDB : HMDB01177 | ||
| + | {{#set: smiles=C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS}} | ||
| + | {{#set: inchi key=InChIKey=RJCJWONCSKSHES-VIFPVBQESA-M}} | ||
| + | {{#set: common name=S-succinyl-dihydrolipoamide}} | ||
| + | {{#set: molecular weight=306.414 }} | ||
| + | {{#set: consumed or produced by=AKGDHe2r}} | ||
Revision as of 16:43, 10 January 2018
Contents
Metabolite CPD0-341
- smiles:
- C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS
- inchi key:
- InChIKey=RJCJWONCSKSHES-VIFPVBQESA-M
- common name:
- S-succinyl-dihydrolipoamide
- molecular weight:
- 306.414
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS" cannot be used as a page name in this wiki.
