Difference between revisions of "Tiso gene 13231"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3616 == * left end position: ** 10769 * transcription direction: ** POSITIVE * right end position: ** 13845 * centisome position: ** 61.291...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] ==
+
== Gene Tiso_gene_3616 ==
−
* smiles:
+
* left end position:
−
** [CH](=O)C(C(C(C(CO)O)O)O)O
+
** 10769
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** aldehydo-D-galactose
+
** 13845
−
* molecular weight:
+
* centisome position:
−
** 180.157    
+
** 61.291973    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[ACETATE--COA-LIGASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** in-silico_annotation
−
* [[RXN-14409]]
+
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY66-161]]
 +
* [[PWY66-21]]
 +
* [[PWY66-162]]
 +
* [[PWY0-1313]]
 +
* [[PWY-6672]]
 +
* [[PWY-7118]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=10769}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01582 C01582]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=13845}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17118 17118]
+
{{#set: centisome position=61.291973    }}
−
* PUBCHEM:
+
{{#set: reaction associated=ACETATE--COA-LIGASE-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3037556 3037556]
+
{{#set: pathway associated=PWY66-161|PWY66-21|PWY66-162|PWY0-1313|PWY-6672|PWY-7118}}
−
{{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}}
+
−
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N}}
+
−
{{#set: common name=aldehydo-D-galactose}}
+
−
{{#set: molecular weight=180.157    }}
+
−
{{#set: consumed or produced by=RXN-14409}}
+

Revision as of 16:44, 10 January 2018

Gene Tiso_gene_3616

  • left end position:
    • 10769
  • transcription direction:
    • POSITIVE
  • right end position:
    • 13845
  • centisome position:
    • 61.291973
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13231&oldid=14383"