Difference between revisions of "Beta-D-glucosides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_14633 == * left end position: ** 3946 * transcription direction: ** NEGATIVE * right end position: ** 5478 * centisome position: ** 71.4078...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] ==
+
== Gene Tiso_gene_14633 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3946
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** pristanoyl-CoA
+
** 5478
−
* molecular weight:
+
* centisome position:
−
** 1043.995    
+
** 71.40789    
 
* Synonym(s):
 
* Synonym(s):
−
** 2,6,10,14-tetramethylpentadecanoyl-CoA
 
−
** 2,6,10,14-tetramethylpentadecanoyl-coenzyme A
 
−
** pristanoyl-coenzyme A
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[G6PI]]
−
* [[RXN66-484]]
+
** [[pantograph]]-[[creinhardtii]]
−
== Reaction(s) of unknown directionality ==
+
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3946}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289196 86289196]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=5478}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77250 77250]
+
{{#set: centisome position=71.40789   }}
−
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=G6PI|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN}}
−
{{#set: inchi key=InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J}}
+
−
{{#set: common name=pristanoyl-CoA}}
+
−
{{#set: molecular weight=1043.995   }}
+
−
{{#set: common name=2,6,10,14-tetramethylpentadecanoyl-CoA|2,6,10,14-tetramethylpentadecanoyl-coenzyme A|pristanoyl-coenzyme A}}
+
−
{{#set: produced by=RXN66-484}}
+

Revision as of 16:44, 10 January 2018

Gene Tiso_gene_14633

  • left end position:
    • 3946
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5478
  • centisome position:
    • 71.40789
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Beta-D-glucosides&oldid=14401"