Difference between revisions of "CPD0-1081"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SELENOHOMOCYSTEINE SELENOHOMOCYSTEINE] == * smiles: ** C(C[Se])C([N+])C(=O)[O-] * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] == |
* smiles: | * smiles: | ||
| − | ** C(C[ | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J |
* common name: | * common name: | ||
| − | ** | + | ** pristanoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1043.995 |
* Synonym(s): | * Synonym(s): | ||
| − | ** 2- | + | ** 2,6,10,14-tetramethylpentadecanoyl-CoA |
| + | ** 2,6,10,14-tetramethylpentadecanoyl-coenzyme A | ||
| + | ** pristanoyl-coenzyme A | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-484]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289196 86289196] |
| − | * | + | * CHEBI: |
| − | {{#set: smiles=C(C[ | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77250 77250] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J}} |
| − | {{#set: molecular weight= | + | {{#set: common name=pristanoyl-CoA}} |
| − | {{#set: common name=2- | + | {{#set: molecular weight=1043.995 }} |
| − | {{#set: produced by= | + | {{#set: common name=2,6,10,14-tetramethylpentadecanoyl-CoA|2,6,10,14-tetramethylpentadecanoyl-coenzyme A|pristanoyl-coenzyme A}} |
| + | {{#set: produced by=RXN66-484}} | ||
Revision as of 16:45, 10 January 2018
Contents
Metabolite CPD-14675
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J
- common name:
- pristanoyl-CoA
- molecular weight:
- 1043.995
- Synonym(s):
- 2,6,10,14-tetramethylpentadecanoyl-CoA
- 2,6,10,14-tetramethylpentadecanoyl-coenzyme A
- pristanoyl-coenzyme A
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
