Difference between revisions of "Tiso gene 450"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCD19 ALCD19] == * direction: ** REVERSIBLE * common name: ** alcohol dehydrogenase (glycerol, NAD...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] == * smiles: ** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCD19 ALCD19] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J
 
* common name:
 
* common name:
−
** alcohol dehydrogenase (glycerol, NAD)
+
** 4-cis-undecenoyl-CoA
 +
* molecular weight:
 +
** 929.765   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4Z-undecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14775]]
−
** 1.0 [[GLYCERALD]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADH]][c] '''<=>''' 1.0 [[GLYCEROL]][c] '''+''' 1.0 [[NAD]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-14774]]
−
** 1.0 D-glyceraldehyde[c] '''+''' 1.0 H+[c] '''+''' 1.0 NADH[c] '''<=>''' 1.0 glycerol[c] '''+''' 1.0 NAD+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14126]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=alcohol dehydrogenase (glycerol, NAD)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658173 90658173]
−
{{#set: gene associated=Tiso_gene_14126}}
+
{{#set: smiles=CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: in pathway=}}
+
{{#set: inchi key=InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=4-cis-undecenoyl-CoA}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=929.765    }}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: common name=4Z-undecenoyl-CoA}}
 +
{{#set: consumed by=RXN-14775}}
 +
{{#set: produced by=RXN-14774}}

Revision as of 16:45, 10 January 2018

Metabolite CPD-15668

  • smiles:
    • CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J
  • common name:
    • 4-cis-undecenoyl-CoA
  • molecular weight:
    • 929.765
  • Synonym(s):
    • 4Z-undecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_450&oldid=14475"