Difference between revisions of "Beta-Lactams"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2747 CPD-2747] == * smiles: ** C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3718 == * left end position: ** 14575 * transcription direction: ** POSITIVE * right end position: ** 16010 * centisome position: ** 90.331...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2747 CPD-2747] ==
+
== Gene Tiso_gene_3718 ==
−
* smiles:
+
* left end position:
−
** C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
+
** 14575
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XWZCZWKUGIQPJD-CVRQRIFOSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** cotinine-glucuronide
+
** 16010
−
* molecular weight:
+
* centisome position:
−
** 352.343    
+
** 90.33158    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[1.1.1.8-RXN]]
−
* [[RXN66-168]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6118]]
 +
* [[PWY-7385]]
 +
* [[PWY-5981]]
 +
* [[PWY-5667]]
 +
* [[PWY0-1319]]
 +
* [[PWY-7411]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=14575}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820250 91820250]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB01013
+
{{#set: right end position=16010}}
−
{{#set: smiles=C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}}
+
{{#set: centisome position=90.33158    }}
−
{{#set: inchi key=InChIKey=XWZCZWKUGIQPJD-CVRQRIFOSA-N}}
+
{{#set: reaction associated=1.1.1.8-RXN|GLYC3PDEHYDROGBIOSYN-RXN}}
−
{{#set: common name=cotinine-glucuronide}}
+
{{#set: pathway associated=PWY-6118|PWY-7385|PWY-5981|PWY-5667|PWY0-1319|PWY-7411}}
−
{{#set: molecular weight=352.343    }}
+
−
{{#set: produced by=RXN66-168}}
+

Revision as of 16:45, 10 January 2018

Gene Tiso_gene_3718

  • left end position:
    • 14575
  • transcription direction:
    • POSITIVE
  • right end position:
    • 16010
  • centisome position:
    • 90.33158
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Beta-Lactams&oldid=14500"