Difference between revisions of "Tiso gene 18943"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...")
 
(Created page with "Category:Gene == Gene Tiso_gene_92 == * left end position: ** 20519 * transcription direction: ** POSITIVE * right end position: ** 22089 * centisome position: ** 45.38698...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] ==
+
== Gene Tiso_gene_92 ==
−
* smiles:
+
* left end position:
−
** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])
+
** 20519
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 9-mercaptodethiobiotin
+
** 22089
−
* molecular weight:
+
* centisome position:
−
** 245.316    
+
** 45.38698    
 
* Synonym(s):
 
* Synonym(s):
−
** 9-mercaptodesthiobiotin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17473]]
+
* [[DIHYDROFOLATESYNTH-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[synechocystis]]
−
* [[RXN-17472]]
+
* [[FOLYLPOLYGLUTAMATESYNTH-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** in-silico_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[FORMYLTHFGLUSYNTH-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN-6341]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN0-2921]]
 +
** in-silico_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-2161]]
 +
* [[PWY-6614]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=20519}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244092 25244092]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])}}
+
{{#set: right end position=22089}}
−
{{#set: inchi key=InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M}}
+
{{#set: centisome position=45.38698   }}
−
{{#set: common name=9-mercaptodethiobiotin}}
+
{{#set: reaction associated=DIHYDROFOLATESYNTH-RXN|FOLYLPOLYGLUTAMATESYNTH-RXN|FORMYLTHFGLUSYNTH-RXN|RXN-6341|RXN0-2921}}
−
{{#set: molecular weight=245.316   }}
+
{{#set: pathway associated=PWY-2161|PWY-6614}}
−
{{#set: common name=9-mercaptodesthiobiotin}}
+
−
{{#set: consumed by=RXN-17473}}
+
−
{{#set: produced by=RXN-17472}}
+

Revision as of 16:46, 10 January 2018

Gene Tiso_gene_92

  • left end position:
    • 20519
  • transcription direction:
    • POSITIVE
  • right end position:
    • 22089
  • centisome position:
    • 45.38698
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18943&oldid=14537"