Difference between revisions of "Tiso gene 1676"

Revision as of 16:46, 10 January 2018

"C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Rhodopsins Rhodopsins] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2747 CPD-2747] ==
+* smiles:
+** C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
+* inchi key:
+** InChIKey=XWZCZWKUGIQPJD-CVRQRIFOSA-N
 * common name:
-** a rhodopsin
+** cotinine-glucuronide
+* molecular weight:
+** 352.343
 * Synonym(s):
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
-* [[RHODOPSINRT]]
+* [[RXN66-168]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: common name=a rhodopsin}}
+* PUBCHEM:
-{{#set: produced by=RHODOPSINRT}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820250 91820250]
+* HMDB : HMDB01013
+{{#set: smiles=C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}}
+{{#set: inchi key=InChIKey=XWZCZWKUGIQPJD-CVRQRIFOSA-N}}
+{{#set: common name=cotinine-glucuronide}}
+{{#set: molecular weight=352.343    }}
+{{#set: produced by=RXN66-168}}