Difference between revisions of "RXN-14208"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == * smiles: ** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3))) * inchi...")
 
(Created page with "Category:Gene == Gene Tiso_gene_11164 == * left end position: ** 2174 * transcription direction: ** POSITIVE * right end position: ** 3854 * centisome position: ** 27.2328...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] ==
+
== Gene Tiso_gene_11164 ==
−
* smiles:
+
* left end position:
−
** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))
+
** 2174
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** apigenin
+
** 3854
−
* molecular weight:
+
* centisome position:
−
** 269.233    
+
** 27.23287    
 
* Synonym(s):
 
* Synonym(s):
−
** 4',5,7-trihydroxyflavone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7651]]
+
* [[OROPRIBTRANS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7790]]
 +
* [[PWY-7791]]
 +
* [[PWY-5686]]
 
== External links  ==
 
== External links  ==
−
* CAS : 520-36-5
+
{{#set: left end position=2174}}
−
* LIPID_MAPS : LMPK12110005
+
{{#set: transcription direction=POSITIVE}}
−
* PUBCHEM:
+
{{#set: right end position=3854}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200950 25200950]
+
{{#set: centisome position=27.23287   }}
−
* HMDB : HMDB02124
+
{{#set: reaction associated=OROPRIBTRANS-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7790|PWY-7791|PWY-5686}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01477 C01477]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58470 58470]
+
−
{{#set: smiles=C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))}}
+
−
{{#set: inchi key=InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M}}
+
−
{{#set: common name=apigenin}}
+
−
{{#set: molecular weight=269.233   }}
+
−
{{#set: common name=4',5,7-trihydroxyflavone}}
+
−
{{#set: consumed by=RXN-7651}}
+

Revision as of 16:46, 10 January 2018

Gene Tiso_gene_11164

  • left end position:
    • 2174
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3854
  • centisome position:
    • 27.23287
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14208&oldid=14558"