Difference between revisions of "ALDDH"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1676 == * Synonym(s): == Reactions associated == * ADENOSINETRIPHOSPHATASE-RXN ** pantograph-esiliculosus == Pathways associat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inchi k...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == |
+ | * smiles: | ||
+ | ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M | ||
+ | * common name: | ||
+ | ** S-sulfanylglutathione | ||
+ | * molecular weight: | ||
+ | ** 338.373 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** GSSH | ||
+ | ** glutathione-sulfide | ||
+ | ** glutathione persulfide | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-15348]] | |
− | + | == Reaction(s) of unknown directionality == | |
+ | * [[RXN-10851]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878477 46878477] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58905 58905] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C17267 C17267] | ||
+ | {{#set: smiles=C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M}} | ||
+ | {{#set: common name=S-sulfanylglutathione}} | ||
+ | {{#set: molecular weight=338.373 }} | ||
+ | {{#set: common name=GSSH|glutathione-sulfide|glutathione persulfide}} | ||
+ | {{#set: produced by=RXN-15348}} | ||
+ | {{#set: consumed or produced by=RXN-10851}} |
Revision as of 17:46, 10 January 2018
Contents
Metabolite CPD-11281
- smiles:
- C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
- inchi key:
- InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M
- common name:
- S-sulfanylglutathione
- molecular weight:
- 338.373
- Synonym(s):
- GSSH
- glutathione-sulfide
- glutathione persulfide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.