Difference between revisions of "PANTOTHENATE-KIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15211 RXN-15211] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * smiles: ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] * inchi key: ** InChIKey=ZBCBET...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15211 RXN-15211] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C([O-])(=O)CC=CC=C(O)C(=O)[O-]
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.8.27 EC-2.7.8.27]
+
** InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L
 +
* common name:
 +
** (2Z,4Z)-2-hydroxyhepta-2,4-dienedioate
 +
* molecular weight:
 +
** 170.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** (2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate
 +
** HHDD
 +
** (2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN1K-87]]
−
** 1 [[N-Acylsphingosine]][c] '''+''' 1 [[PHOSPHATIDYLCHOLINE]][c] '''=>''' 1 [[DIACYLGLYCEROL]][c] '''+''' 1 [[N-acyl-sphingosylphosphorylcholine]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a sphingosine ceramide[c] '''+''' 1 a phosphatidylcholine[c] '''=>''' 1 a 1,2-diacyl-sn-glycerol[c] '''+''' 1 an N-acyl-sphingosylphosphorylcholine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7277]], sphingolipid biosynthesis (mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7277 PWY-7277]
+
−
** '''5''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY3DJ-11281]], sphingomyelin metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11281 PWY3DJ-11281]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.7.8.27}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91828271 91828271]
−
{{#set: in pathway=PWY-7277|PWY3DJ-11281}}
+
* CHEMSPIDER:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.chemspider.com/Chemical-Structure.11531600.html 11531600]
−
{{#set: reconstruction tool=pathwaytools}}
+
* CHEBI:
−
{{#set: reconstruction source=in-silico_annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87504 87504]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05600 C05600]
 +
{{#set: smiles=C([O-])(=O)CC=CC=C(O)C(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L}}
 +
{{#set: common name=(2Z,4Z)-2-hydroxyhepta-2,4-dienedioate}}
 +
{{#set: molecular weight=170.121    }}
 +
{{#set: common name=(2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate|HHDD|(2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate}}
 +
{{#set: consumed by=RXN1K-87}}

Revision as of 16:46, 10 January 2018

Metabolite CPD-787

  • smiles:
    • C([O-])(=O)CC=CC=C(O)C(=O)[O-]
  • inchi key:
    • InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L
  • common name:
    • (2Z,4Z)-2-hydroxyhepta-2,4-dienedioate
  • molecular weight:
    • 170.121
  • Synonym(s):
    • (2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate
    • HHDD
    • (2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)CC=CC=C(O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PANTOTHENATE-KIN-RXN&oldid=14581"