Difference between revisions of "Tiso gene 7378"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * inchi key: ** InChIKey=PCKPVGOLPK...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C2(C=CC1(=C(C(O)=CN1)C=2)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** indoxyl |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 133.149 |
* Synonym(s): | * Synonym(s): | ||
| + | ** indole-3-ol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-15587]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50591 50591] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.45861.html 45861] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17840 17840] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05658 C05658] |
| − | * HMDB : | + | * HMDB : HMDB04094 |
| − | {{#set: smiles= | + | {{#set: smiles=C2(C=CC1(=C(C(O)=CN1)C=2))}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=indoxyl}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=133.149 }} |
| − | {{#set: | + | {{#set: common name=indole-3-ol}} |
| + | {{#set: consumed or produced by=RXN-15587}} | ||
Revision as of 16:47, 10 January 2018
Contents
Metabolite INDOXYL
- smiles:
- C2(C=CC1(=C(C(O)=CN1)C=2))
- inchi key:
- InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N
- common name:
- indoxyl
- molecular weight:
- 133.149
- Synonym(s):
- indole-3-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
