Difference between revisions of "DHRT ibcoa"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17464 CPD-17464] == * smiles: ** CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_11381 == * left end position: ** 10463 * transcription direction: ** POSITIVE * right end position: ** 13023 * centisome position: ** 79.97...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17464 CPD-17464] ==
+
== Gene Tiso_gene_11381 ==
* smiles:
+
* left end position:
** CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 10463
* inchi key:
+
* transcription direction:
** InChIKey=GIIFECKTWKZXGU-FJXLYLFVSA-J
+
** POSITIVE
* common name:
+
* right end position:
** (9Z)-tetradecenoyl-CoA
+
** 13023
* molecular weight:
+
* centisome position:
** 971.845    
+
** 79.974014    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[2.7.1.68-RXN]]
* [[RXN-16561]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-6352]]
 +
* [[PWY-6351]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=10463}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678739 70678739]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=13023}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65060 65060]
+
{{#set: centisome position=79.974014    }}
{{#set: smiles=CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=2.7.1.68-RXN}}
{{#set: inchi key=InChIKey=GIIFECKTWKZXGU-FJXLYLFVSA-J}}
+
{{#set: pathway associated=PWY-6352|PWY-6351}}
{{#set: common name=(9Z)-tetradecenoyl-CoA}}
+
{{#set: molecular weight=971.845    }}
+
{{#set: produced by=RXN-16561}}
+

Revision as of 16:47, 10 January 2018

Gene Tiso_gene_11381

  • left end position:
    • 10463
  • transcription direction:
    • POSITIVE
  • right end position:
    • 13023
  • centisome position:
    • 79.974014
  • Synonym(s):

Reactions associated

Pathways associated

External links