Difference between revisions of "Tiso gene 10840"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-240 RXN1G-240] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-delta9-3-oxo-C28:1-[acy...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-240 RXN1G-240] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** cis-delta9-3-oxo-C28:1-[acyl-carrier protein] reductase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.M9 EC-1.1.1.M9] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[cis-delta9-3-oxo-montanoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[cis-delta9-3-hydroxymontanoyl-ACPs]][c] '''+''' 1 [[NADP]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 a cis-delta9-3-oxo-C28:1-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 a cis-delta9-3-hydroxyC28:1-[acp][c] '''+''' 1 NADP+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_13083]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
| + | ** '''86''' reactions found over '''182''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[esiliculosus]] | ||
| + | * [[annotation]]: | ||
| + | ** [[pathwaytools]]: | ||
| + | *** [[experimental_annotation]] | ||
| + | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=cis-delta9-3-oxo-C28:1-[acyl-carrier protein] reductase}} | |
| − | + | {{#set: ec number=EC-1.1.1.M9}} | |
| − | + | {{#set: gene associated=Tiso_gene_13083}} | |
| − | + | {{#set: in pathway=PWYG-321}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=esiliculosus}} | |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:47, 10 January 2018
Contents
Reaction RXN1G-240
- direction:
- LEFT-TO-RIGHT
- common name:
- cis-delta9-3-oxo-C28:1-[acyl-carrier protein] reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 cis-delta9-3-oxo-montanoyl-ACPs[c] + 1 PROTON[c] + 1 NADPH[c] => 1 cis-delta9-3-hydroxymontanoyl-ACPs[c] + 1 NADP[c]
- With common name(s):
- 1 a cis-delta9-3-oxo-C28:1-[acp][c] + 1 H+[c] + 1 NADPH[c] => 1 a cis-delta9-3-hydroxyC28:1-[acp][c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links
"cis-delta9-3-oxo-C28:1-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.
