Difference between revisions of "Tiso gene 18971"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_14419 == * left end position: ** 443 * transcription direction: ** NEGATIVE * right end position: ** 4610 * centisome position: ** 7.815808...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_14419 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] ==
−
* left end position:
+
* smiles:
−
** 443
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N
−
* right end position:
+
* common name:
−
** 4610
+
** 6-deoxotyphasterol
−
* centisome position:
+
* molecular weight:
−
** 7.8158083    
+
** 434.701    
 
* Synonym(s):
 
* Synonym(s):
 +
** deoxotyphasterol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN0-4261]]
+
* [[RXN-4241]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=443}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061346 16061346]
−
{{#set: right end position=4610}}
+
* CHEBI:
−
{{#set: centisome position=7.8158083   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20717 20717]
−
{{#set: reaction associated=RXN0-4261}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15801 C15801]
 +
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N}}
 +
{{#set: common name=6-deoxotyphasterol}}
 +
{{#set: molecular weight=434.701   }}
 +
{{#set: common name=deoxotyphasterol}}
 +
{{#set: consumed by=RXN-4241}}

Revision as of 16:47, 10 January 2018

Metabolite CPD-720

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N
  • common name:
    • 6-deoxotyphasterol
  • molecular weight:
    • 434.701
  • Synonym(s):
    • deoxotyphasterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18971&oldid=14668"