Difference between revisions of "Tiso gene 18971"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14419 == * left end position: ** 443 * transcription direction: ** NEGATIVE * right end position: ** 4610 * centisome position: ** 7.815808...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N |
− | * | + | * common name: |
− | ** | + | ** 6-deoxotyphasterol |
− | * | + | * molecular weight: |
− | ** | + | ** 434.701 |
* Synonym(s): | * Synonym(s): | ||
+ | ** deoxotyphasterol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-4241]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061346 16061346] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20717 20717] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15801 C15801] | ||
+ | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: inchi key=InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N}} | ||
+ | {{#set: common name=6-deoxotyphasterol}} | ||
+ | {{#set: molecular weight=434.701 }} | ||
+ | {{#set: common name=deoxotyphasterol}} | ||
+ | {{#set: consumed by=RXN-4241}} |
Revision as of 16:47, 10 January 2018
Contents
Metabolite CPD-720
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N
- common name:
- 6-deoxotyphasterol
- molecular weight:
- 434.701
- Synonym(s):
- deoxotyphasterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.